C36H40ClF5N4O4 — CID 58920462
4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(6-oxoheptyl)cyclohexane-1-carboxamide (PubChem CID 58920462) has the molecular formula C36H40ClF5N4O4 and a molecular weight of 723.18 g/mol. Its IUPAC name is 4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(6-oxoheptyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(6-oxoheptyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58920462 |
| Molecular Formula | C36H40ClF5N4O4 |
| Molecular Weight | 723.18 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | 4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(6-oxoheptyl)cyclohexane-1-carboxamide |
| SMILES | CC(=O)CCCCCNC(=O)C1CCC(NC(=O)N[C@@](Cc2ccccc2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C36H40ClF5N4O4/c1-23(47)8-4-3-7-17-43-32(48)25-11-14-29(15-12-25)45-34(49)46-35(21-24-9-5-2-6-10-24,31-16-13-27(37)22-44-31)26-18-28(38)20-30(19-26)50-36(41,42)33(39)40/h2,5-6,9-10,13,16,18-20,22,25,29,33H,3-4,7-8,11-12,14-15,17,21H2,1H3,(H,43,48)(H2,45,46,49)/t25?,29?,35-/m0/s1 |
| InChIKey | BKWPEXXMJJVSFX-DWOKUQQZSA-N |
| XLogP | 7.72 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.18 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|