C26H19ClF11N3O3 — CID 58920485
2-amino-N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanamide (PubChem CID 58920485) has the molecular formula C26H19ClF11N3O3 and a molecular weight of 665.89 g/mol. Its IUPAC name is 2-amino-N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanamide.
| Compound Name | 2-amino-N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 58920485 |
| Molecular Formula | C26H19ClF11N3O3 |
| Molecular Weight | 665.89 g/mol |
| Exact Mass | 665.09 |
| IUPAC Name | 2-amino-N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanamide |
| SMILES | NC(C(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H19ClF11N3O3/c27-15-6-7-18(40-12-15)22(11-13-4-2-1-3-5-13,14-8-16(28)10-17(9-14)44-24(31,32)21(29)30)41-20(42)19(39)23(43,25(33,34)35)26(36,37)38/h1-10,12,19,21,43H,11,39H2,(H,41,42)/t19?,22-/m0/s1 |
| InChIKey | ZHNVPGYPGBIXIY-BPARTEKVSA-N |
| XLogP | 5.90 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.89 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|