C31H30ClF5N4O5 — CID 58920607
methyl 2-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclopentanecarbonyl]amino]acetate (PubChem CID 58920607) has the molecular formula C31H30ClF5N4O5 and a molecular weight of 669.05 g/mol. Its IUPAC name is methyl 2-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclopentanecarbonyl]amino]acetate.
| Compound Name | methyl 2-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclopentanecarbonyl]amino]acetate |
|---|---|
| PubChem CID | 58920607 |
| Molecular Formula | C31H30ClF5N4O5 |
| Molecular Weight | 669.05 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | methyl 2-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclopentanecarbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H]1CCC[C@H]1NC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C31H30ClF5N4O5/c1-45-26(42)17-39-27(43)23-8-5-9-24(23)40-29(44)41-30(15-18-6-3-2-4-7-18,25-11-10-20(32)16-38-25)19-12-21(33)14-22(13-19)46-31(36,37)28(34)35/h2-4,6-7,10-14,16,23-24,28H,5,8-9,15,17H2,1H3,(H,39,43)(H2,40,41,44)/t23-,24+,30-/m0/s1 |
| InChIKey | PRGKTWSSUMCDNA-BBANNHEPSA-N |
| XLogP | 5.35 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.05 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|