C35H28ClF9N2O4 — CID 58920609
6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenyl]hexanoic acid (PubChem CID 58920609) has the molecular formula C35H28ClF9N2O4 and a molecular weight of 747.05 g/mol. Its IUPAC name is 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenyl]hexanoic acid.
| Compound Name | 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 58920609 |
| Molecular Formula | C35H28ClF9N2O4 |
| Molecular Weight | 747.05 g/mol |
| Exact Mass | 746.16 |
| IUPAC Name | 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenyl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1ccc(C[C@](NC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C35H28ClF9N2O4/c36-24-11-13-29(46-19-24)33(23-15-25(37)17-26(16-23)51-35(44,45)32(39)40,47-31(50)22-10-12-28(38)27(14-22)34(41,42)43)18-21-8-6-20(7-9-21)4-2-1-3-5-30(48)49/h6-17,19,32H,1-5,18H2,(H,47,50)(H,48,49)/t33-/m0/s1 |
| InChIKey | LGMFEPSBAJJXPB-XIFFEERXSA-N |
| XLogP | 9.37 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.05 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|