C25H18ClF10N3O2 — CID 58920709
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,3,3,3-pentafluoropropyl)urea (PubChem CID 58920709) has the molecular formula C25H18ClF10N3O2 and a molecular weight of 617.87 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,3,3,3-pentafluoropropyl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,3,3,3-pentafluoropropyl)urea |
|---|---|
| PubChem CID | 58920709 |
| Molecular Formula | C25H18ClF10N3O2 |
| Molecular Weight | 617.87 g/mol |
| Exact Mass | 617.09 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,3,3,3-pentafluoropropyl)urea |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H18ClF10N3O2/c26-16-6-7-19(37-12-16)22(11-14-4-2-1-3-5-14,39-21(40)38-13-23(30,31)25(34,35)36)15-8-17(27)10-18(9-15)41-24(32,33)20(28)29/h1-10,12,20H,11,13H2,(H2,38,39,40)/t22-/m0/s1 |
| InChIKey | MDWIBDBYTJHKEJ-QFIPXVFZSA-N |
| XLogP | 7.09 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.87 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|