C33H24ClF9N2O5 — CID 58920791
4-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]butanoic acid (PubChem CID 58920791) has the molecular formula C33H24ClF9N2O5 and a molecular weight of 735.00 g/mol. Its IUPAC name is 4-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 58920791 |
| Molecular Formula | C33H24ClF9N2O5 |
| Molecular Weight | 735.00 g/mol |
| Exact Mass | 734.12 |
| IUPAC Name | 4-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(C[C@](NC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C33H24ClF9N2O5/c34-21-6-10-27(44-17-21)31(16-18-3-7-23(8-4-18)49-11-1-2-28(46)47,20-13-22(35)15-24(14-20)50-33(42,43)30(37)38)45-29(48)19-5-9-26(36)25(12-19)32(39,40)41/h3-10,12-15,17,30H,1-2,11,16H2,(H,45,48)(H,46,47)/t31-/m0/s1 |
| InChIKey | VLZMSPGOTFEORA-HKBQPEDESA-N |
| XLogP | 8.43 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.00 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|