C31H24ClF7N2O3 — CID 58920927
(2R)-N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide (PubChem CID 58920927) has the molecular formula C31H24ClF7N2O3 and a molecular weight of 640.98 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide.
| Compound Name | (2R)-N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide |
|---|---|
| PubChem CID | 58920927 |
| Molecular Formula | C31H24ClF7N2O3 |
| Molecular Weight | 640.98 g/mol |
| Exact Mass | 640.14 |
| IUPAC Name | (2R)-N-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide |
| SMILES | CO[C@@](C(=O)N[C@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H24ClF7N2O3/c1-43-29(31(37,38)39,21-11-6-3-7-12-21)27(42)41-28(18-20-9-4-2-5-10-20,25-16-15-23(32)19-40-25)22-13-8-14-24(17-22)44-30(35,36)26(33)34/h2-17,19,26H,18H2,1H3,(H,41,42)/t28-,29-/m1/s1 |
| InChIKey | WZXVDHTZDOSCAW-FQLXRVMXSA-N |
| XLogP | 7.68 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.98 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|