C31H23ClF8N2O3 — CID 58921350
(2S)-N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide (PubChem CID 58921350) has the molecular formula C31H23ClF8N2O3 and a molecular weight of 658.97 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide.
| Compound Name | (2S)-N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide |
|---|---|
| PubChem CID | 58921350 |
| Molecular Formula | C31H23ClF8N2O3 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.13 |
| IUPAC Name | (2S)-N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide |
| SMILES | CO[C@](C(=O)N[C@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H23ClF8N2O3/c1-44-29(31(38,39)40,20-10-6-3-7-11-20)27(43)42-28(17-19-8-4-2-5-9-19,25-13-12-22(32)18-41-25)21-14-23(33)16-24(15-21)45-30(36,37)26(34)35/h2-16,18,26H,17H2,1H3,(H,42,43)/t28-,29+/m1/s1 |
| InChIKey | LAQNBRIUSIRGMV-WDYNHAJCSA-N |
| XLogP | 7.82 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|