C36H21F13N2O2 — CID 58921503
N-[2-(3,4-difluorophenyl)-1-[5-[(3,4-difluorophenyl)methyl]-2-pyridinyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 58921503) has the molecular formula C36H21F13N2O2 and a molecular weight of 760.55 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)-1-[5-[(3,4-difluorophenyl)methyl]-2-pyridinyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(3,4-difluorophenyl)-1-[5-[(3,4-difluorophenyl)methyl]-2-pyridinyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58921503 |
| Molecular Formula | C36H21F13N2O2 |
| Molecular Weight | 760.55 g/mol |
| Exact Mass | 760.14 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)-1-[5-[(3,4-difluorophenyl)methyl]-2-pyridinyl]-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NC(Cc1ccc(F)c(F)c1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cc2ccc(F)c(F)c2)cn1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H21F13N2O2/c37-23-13-22(14-24(15-23)53-36(48,49)33(43)44)34(16-19-2-6-28(40)30(42)11-19,51-32(52)21-4-7-26(38)25(12-21)35(45,46)47)31-8-3-20(17-50-31)9-18-1-5-27(39)29(41)10-18/h1-8,10-15,17,33H,9,16H2,(H,51,52) |
| InChIKey | UOYUZMVYNFPLTG-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.55 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|