C10H18 — CID 58921505
(2R,4S)-2-propan-2-ylbicyclo[2.2.1]heptane (PubChem CID 58921505) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (2R,4S)-2-propan-2-ylbicyclo[2.2.1]heptane.
| Compound Name | (2R,4S)-2-propan-2-ylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 58921505 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (2R,4S)-2-propan-2-ylbicyclo[2.2.1]heptane |
| SMILES | CC(C)[C@H]1C[C@H]2CCC1C2 |
| InChI | InChI=1S/C10H18/c1-7(2)10-6-8-3-4-9(10)5-8/h7-10H,3-6H2,1-2H3/t8-,9?,10+/m0/s1 |
| InChIKey | SPDGGMLOTGMUGR-DJBFQZMMSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |