C29H34N4O3 — CID 58923447
1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxoethyl]-3-cyclohexyl-2-pyridin-3-ylindole-6-carboxylic acid (PubChem CID 58923447) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxoethyl]-3-cyclohexyl-2-pyridin-3-ylindole-6-carboxylic acid.
| Compound Name | 1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxoethyl]-3-cyclohexyl-2-pyridin-3-ylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 58923447 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxoethyl]-3-cyclohexyl-2-pyridin-3-ylindole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c(-c3cccnc3)n(CC(=O)N3CCN4CCCC4C3)c2c1 |
| InChI | InChI=1S/C29H34N4O3/c34-26(32-15-14-31-13-5-9-23(31)18-32)19-33-25-16-21(29(35)36)10-11-24(25)27(20-6-2-1-3-7-20)28(33)22-8-4-12-30-17-22/h4,8,10-12,16-17,20,23H,1-3,5-7,9,13-15,18-19H2,(H,35,36) |
| InChIKey | FRPCODHSFNHESZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |