potassium 2-methoxyethylsulfamoylazanide

C3H9KN2O3S — CID 58923853

IUPACpotassium 2-methoxyethylsulfamoylazanide
SMILESCOCCNS([NH-])(=O)=O.[K+]
InChIInChI=1S/C3H9N2O3S.K/c1-8-3-2-5-9(4,6)7;/h5H,2-3H2,1H3,(H-,4,6,7);/q-1;+1
InChIKeySFOUPNKKHOERET-UHFFFAOYSA-N
MW192.28 g/mol
LogP-3.48
Rot. Bonds4

About potassium 2-methoxyethylsulfamoylazanide

potassium 2-methoxyethylsulfamoylazanide (PubChem CID 58923853) has the molecular formula C3H9KN2O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is potassium 2-methoxyethylsulfamoylazanide.

Molecular Properties

Compound Namepotassium 2-methoxyethylsulfamoylazanide
PubChem CID58923853
Molecular FormulaC3H9KN2O3S
Molecular Weight192.28 g/mol
Exact Mass192.00
IUPAC Namepotassium 2-methoxyethylsulfamoylazanide
SMILESCOCCNS([NH-])(=O)=O.[K+]
InChIInChI=1S/C3H9N2O3S.K/c1-8-3-2-5-9(4,6)7;/h5H,2-3H2,1H3,(H-,4,6,7);/q-1;+1
InChIKeySFOUPNKKHOERET-UHFFFAOYSA-N
XLogP-3.48
TPSA79.20 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.28
LogP ≤ 5-3.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze potassium 2-methoxyethylsulfamoylazanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-methoxyethylsulfamoylazanide?
The IUPAC name of potassium 2-methoxyethylsulfamoylazanide (CID 58923853) is potassium 2-methoxyethylsulfamoylazanide.
What is the SMILES notation for potassium 2-methoxyethylsulfamoylazanide?
The canonical SMILES for potassium 2-methoxyethylsulfamoylazanide is COCCNS([NH-])(=O)=O.[K+].
What is the InChIKey of potassium 2-methoxyethylsulfamoylazanide?
The InChIKey is SFOUPNKKHOERET-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N2O3S.K/c1-8-3-2-5-9(4,6)7;/h5H,2-3H2,1H3,(H-,4,6,7);/q-1;+1.
What are the key properties of potassium 2-methoxyethylsulfamoylazanide?
potassium 2-methoxyethylsulfamoylazanide has a molecular weight of 192.28 g/mol, XLogP of -3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-methoxyethylsulfamoylazanide is sourced from PubChem (CID 58923853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).