C23H26N2O5 — CID 58924484
5-[4-[[2-(4-ethoxy-3-methoxyphenyl)ethylamino]methyl]phenyl]-N-hydroxyfuran-2-carboxamide (PubChem CID 58924484) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-[4-[[2-(4-ethoxy-3-methoxyphenyl)ethylamino]methyl]phenyl]-N-hydroxyfuran-2-carboxamide.
| Compound Name | 5-[4-[[2-(4-ethoxy-3-methoxyphenyl)ethylamino]methyl]phenyl]-N-hydroxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 58924484 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 5-[4-[[2-(4-ethoxy-3-methoxyphenyl)ethylamino]methyl]phenyl]-N-hydroxyfuran-2-carboxamide |
| SMILES | CCOc1ccc(CCNCc2ccc(-c3ccc(C(=O)NO)o3)cc2)cc1OC |
| InChI | InChI=1S/C23H26N2O5/c1-3-29-20-9-6-16(14-22(20)28-2)12-13-24-15-17-4-7-18(8-5-17)19-10-11-21(30-19)23(26)25-27/h4-11,14,24,27H,3,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | FWFCHPBKWJRARL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|