About 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide
5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide (PubChem CID 58924532) has the molecular formula C21H18N2O3S
and a molecular weight of 378.45 g/mol. Its IUPAC name is 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide |
| PubChem CID | 58924532 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide |
| SMILES | O=C(NO)c1ccc(-c2ccc3c(c2)CN(C(=O)c2ccccc2)CC3)s1 |
| InChI | InChI=1S/C21H18N2O3S/c24-20(22-26)19-9-8-18(27-19)16-7-6-14-10-11-23(13-17(14)12-16)21(25)15-4-2-1-3-5-15/h1-9,12,26H,10-11,13H2,(H,22,24) |
| InChIKey | RAHMZUWONMUFGW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide?
The IUPAC name of 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide (CID 58924532) is 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide.
What is the SMILES notation for 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide?
The canonical SMILES for 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide is O=C(NO)c1ccc(-c2ccc3c(c2)CN(C(=O)c2ccccc2)CC3)s1.
What is the InChIKey of 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide?
The InChIKey is RAHMZUWONMUFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O3S/c24-20(22-26)19-9-8-18(27-19)16-7-6-14-10-11-23(13-17(14)12-16)21(25)15-4-2-1-3-5-15/h1-9,12,26H,10-11,13H2,(H,22,24).
What are the key properties of 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide?
5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide has a molecular weight of 378.45 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-benzoyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-hydroxythiophene-2-carboxamide is sourced from PubChem (CID 58924532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).