C17H30O3 — CID 58924672
(2S,3S,4S)-4-(1-hydroxyethyl)-2-methoxy-3-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one (PubChem CID 58924672) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (2S,3S,4S)-4-(1-hydroxyethyl)-2-methoxy-3-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one.
| Compound Name | (2S,3S,4S)-4-(1-hydroxyethyl)-2-methoxy-3-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 58924672 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (2S,3S,4S)-4-(1-hydroxyethyl)-2-methoxy-3-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
| SMILES | CO[C@@H]1C(=O)CC[C@H](C(C)O)[C@H]1/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C17H30O3/c1-11(2)7-6-8-12(3)16-14(13(4)18)9-10-15(19)17(16)20-5/h8,11,13-14,16-18H,6-7,9-10H2,1-5H3/b12-8+/t13?,14-,16-,17-/m1/s1 |
| InChIKey | AHNKNXVUQUEUHI-JYHBTIDESA-N |
| XLogP | 3.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|