C19H22N2OS — CID 58924870
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 58924870) has the molecular formula C19H22N2OS and a molecular weight of 326.46 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-phenyl-1,3-thiazol-4-yl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-phenyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 58924870 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2ccccc2)n1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C19H22N2OS/c22-19(21-11-10-14-6-4-5-9-16(14)12-21)17-13-23-18(20-17)15-7-2-1-3-8-15/h1-3,7-8,13-14,16H,4-6,9-12H2 |
| InChIKey | OGKCFALEDCEZHD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |