C7H13N3 — CID 58925056
1,2,4,6-tetramethyl-2H-1,3,5-triazine (PubChem CID 58925056) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,2,4,6-tetramethyl-2H-1,3,5-triazine.
| Compound Name | 1,2,4,6-tetramethyl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 58925056 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1,2,4,6-tetramethyl-2H-1,3,5-triazine |
| SMILES | CC1=NC(C)N(C)C(C)=N1 |
| InChI | InChI=1S/C7H13N3/c1-5-8-6(2)10(4)7(3)9-5/h6H,1-4H3 |
| InChIKey | KSNOYXKMGJBAAT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |