C11H10F6O4 — CID 58925470
10-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one (PubChem CID 58925470) has the molecular formula C11H10F6O4 and a molecular weight of 320.19 g/mol. Its IUPAC name is 10-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one.
| Compound Name | 10-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one |
|---|---|
| PubChem CID | 58925470 |
| Molecular Formula | C11H10F6O4 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 10-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one |
| SMILES | O=C1CC2OC3OC(C(C(F)(F)F)C(F)(F)F)CC3C2O1 |
| InChI | InChI=1S/C11H10F6O4/c12-10(13,14)8(11(15,16)17)5-1-3-7-4(2-6(18)21-7)19-9(3)20-5/h3-5,7-9H,1-2H2 |
| InChIKey | AFTLAGQDLBJUJR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |