C18H35NO4 — CID 58925595
N-[(2S,4R,5R)-6-ethyl-4,5-dihydroxy-2-methyloxan-3-yl]-8-methylnonanamide (PubChem CID 58925595) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is N-[(2S,4R,5R)-6-ethyl-4,5-dihydroxy-2-methyloxan-3-yl]-8-methylnonanamide.
| Compound Name | N-[(2S,4R,5R)-6-ethyl-4,5-dihydroxy-2-methyloxan-3-yl]-8-methylnonanamide |
|---|---|
| PubChem CID | 58925595 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | N-[(2S,4R,5R)-6-ethyl-4,5-dihydroxy-2-methyloxan-3-yl]-8-methylnonanamide |
| SMILES | CCC1O[C@@H](C)C(NC(=O)CCCCCCC(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H35NO4/c1-5-14-17(21)18(22)16(13(4)23-14)19-15(20)11-9-7-6-8-10-12(2)3/h12-14,16-18,21-22H,5-11H2,1-4H3,(H,19,20)/t13-,14?,16?,17-,18+/m0/s1 |
| InChIKey | GZUADDIRTIREOB-KRLXULGHSA-N |
| XLogP | 2.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|