C16H20Cl2O8 — CID 58925620
[(2R,3S,4S,5R,6R)-2,5-dihydroxy-3-methoxy-6-methyloxan-4-yl] 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate (PubChem CID 58925620) has the molecular formula C16H20Cl2O8 and a molecular weight of 411.23 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2,5-dihydroxy-3-methoxy-6-methyloxan-4-yl] 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-2,5-dihydroxy-3-methoxy-6-methyloxan-4-yl] 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate |
|---|---|
| PubChem CID | 58925620 |
| Molecular Formula | C16H20Cl2O8 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2,5-dihydroxy-3-methoxy-6-methyloxan-4-yl] 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate |
| SMILES | CCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)O[C@H]1[C@H](O)[C@@H](C)O[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C16H20Cl2O8/c1-4-6-7(11(20)9(18)12(21)8(6)17)15(22)26-13-10(19)5(2)25-16(23)14(13)24-3/h5,10,13-14,16,19-21,23H,4H2,1-3H3/t5-,10-,13+,14+,16-/m1/s1 |
| InChIKey | VBHSMPUHODNGNR-UTMXKIGISA-N |
| XLogP | 1.61 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |