C11H20O6 — CID 58925626
[(3S,4R,5S,6R)-4,5,6-trihydroxy-2,2-dimethyloxan-3-yl] 2-methylpropanoate (PubChem CID 58925626) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is [(3S,4R,5S,6R)-4,5,6-trihydroxy-2,2-dimethyloxan-3-yl] 2-methylpropanoate.
| Compound Name | [(3S,4R,5S,6R)-4,5,6-trihydroxy-2,2-dimethyloxan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 58925626 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | [(3S,4R,5S,6R)-4,5,6-trihydroxy-2,2-dimethyloxan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](O)[C@H](O)[C@H](O)OC1(C)C |
| InChI | InChI=1S/C11H20O6/c1-5(2)9(14)16-8-6(12)7(13)10(15)17-11(8,3)4/h5-8,10,12-13,15H,1-4H3/t6-,7+,8+,10-/m1/s1 |
| InChIKey | XIZOJEBAIZXTSP-CHIQAWFVSA-N |
| XLogP | -0.60 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |