C22H24N4O6S — CID 58925902
5-ethyl-2-[[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 58925902) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 5-ethyl-2-[[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-[[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 58925902 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 5-ethyl-2-[[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(ON=C3CCN(S(=O)(=O)Cc4ccc(C)cc4)CC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C22H24N4O6S/c1-3-16-12-18(27)31-21-19(16)20(28)23-22(24-21)32-25-17-8-10-26(11-9-17)33(29,30)13-15-6-4-14(2)5-7-15/h4-7,12H,3,8-11,13H2,1-2H3,(H,23,24,28) |
| InChIKey | IMWHIVQVWVWNOH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|