C21H24F3N3O4 — CID 58925945
5-(2-cyclopentylethyl)-2-[[4-(trifluoromethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 58925945) has the molecular formula C21H24F3N3O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is 5-(2-cyclopentylethyl)-2-[[4-(trifluoromethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-cyclopentylethyl)-2-[[4-(trifluoromethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 58925945 |
| Molecular Formula | C21H24F3N3O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 5-(2-cyclopentylethyl)-2-[[4-(trifluoromethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=c1cc(CCC2CCCC2)c2c(=O)[nH]c(ON=C3CCC(C(F)(F)F)CC3)nc2o1 |
| InChI | InChI=1S/C21H24F3N3O4/c22-21(23,24)14-7-9-15(10-8-14)27-31-20-25-18(29)17-13(6-5-12-3-1-2-4-12)11-16(28)30-19(17)26-20/h11-12,14H,1-10H2,(H,25,26,29)/b27-15- |
| InChIKey | HJRTXIULDLKBDV-DICXZTSXSA-N |
| XLogP | 4.49 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|