C22H21FN4O6 — CID 58925955
ethyl 4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]piperidine-1-carboxylate (PubChem CID 58925955) has the molecular formula C22H21FN4O6 and a molecular weight of 456.43 g/mol. Its IUPAC name is ethyl 4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58925955 |
| Molecular Formula | C22H21FN4O6 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | ethyl 4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=NOc2nc3oc(=O)cc(Cc4cccc(F)c4)c3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C22H21FN4O6/c1-2-31-22(30)27-8-6-16(7-9-27)26-33-21-24-19(29)18-14(12-17(28)32-20(18)25-21)10-13-4-3-5-15(23)11-13/h3-5,11-12H,2,6-10H2,1H3,(H,24,25,29) |
| InChIKey | IWJCUJBUDBVROA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|