About 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole
4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole (PubChem CID 58926427) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole.
Molecular Properties
| Compound Name | 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole |
| PubChem CID | 58926427 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole |
| SMILES | CC(C)=C1OCN=C1C(C)C |
| InChI | InChI=1S/C9H15NO/c1-6(2)8-9(7(3)4)11-5-10-8/h6H,5H2,1-4H3 |
| InChIKey | FMUMFCLLVSZPJQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole?
The IUPAC name of 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole (CID 58926427) is 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole.
What is the SMILES notation for 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole?
The canonical SMILES for 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole is CC(C)=C1OCN=C1C(C)C.
What is the InChIKey of 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole?
The InChIKey is FMUMFCLLVSZPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-6(2)8-9(7(3)4)11-5-10-8/h6H,5H2,1-4H3.
What are the key properties of 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole?
4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole has a molecular weight of 153.22 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-5-propan-2-ylidene-2H-1,3-oxazole is sourced from PubChem (CID 58926427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).