About 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine
2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 58926851) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine.
Analyze 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine?
The IUPAC name of 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine (CID 58926851) is 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine?
The canonical SMILES for 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine is CN1CCN2CCC=C2C1.
What is the InChIKey of 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine?
The InChIKey is YVNJJXGLGIACPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-9-5-6-10-4-2-3-8(10)7-9/h3H,2,4-7H2,1H3.
What are the key properties of 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine?
2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine has a molecular weight of 138.21 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 58926851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).