C35H35F3N2O2S — CID 58927026
5-(7-tert-butylbenzo[g][1,3]benzothiazol-2-yl)-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 58927026) has the molecular formula C35H35F3N2O2S and a molecular weight of 604.74 g/mol. Its IUPAC name is 5-(7-tert-butylbenzo[g][1,3]benzothiazol-2-yl)-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-(7-tert-butylbenzo[g][1,3]benzothiazol-2-yl)-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 58927026 |
| Molecular Formula | C35H35F3N2O2S |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 5-(7-tert-butylbenzo[g][1,3]benzothiazol-2-yl)-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC(C)(C)c1ccc2c(ccc3nc(-c4c(C(F)(F)F)c5cc6c7c(c5oc4=O)C(C)(C)CCN7CCC6(C)C)sc32)c1 |
| InChI | InChI=1S/C35H35F3N2O2S/c1-32(2,3)19-9-10-20-18(16-19)8-11-23-29(20)43-30(39-23)24-25(35(36,37)38)21-17-22-27-26(28(21)42-31(24)41)34(6,7)13-15-40(27)14-12-33(22,4)5/h8-11,16-17H,12-15H2,1-7H3 |
| InChIKey | WWRFTFQXSPXBPH-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|