C26H26Cl2F3FeN3 — CID 58927248
dichloroiron;N-(2,6-dimethylphenyl)-1-[6-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-4-(trifluoromethyl)-2-pyridinyl]ethanimine (PubChem CID 58927248) has the molecular formula C26H26Cl2F3FeN3 and a molecular weight of 564.26 g/mol. Its IUPAC name is dichloroiron;N-(2,6-dimethylphenyl)-1-[6-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-4-(trifluoromethyl)-2-pyridinyl]ethanimine.
| Compound Name | dichloroiron;N-(2,6-dimethylphenyl)-1-[6-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-4-(trifluoromethyl)-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 58927248 |
| Molecular Formula | C26H26Cl2F3FeN3 |
| Molecular Weight | 564.26 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | dichloroiron;N-(2,6-dimethylphenyl)-1-[6-[N-(2,6-dimethylphenyl)-C-methylcarbonimidoyl]-4-(trifluoromethyl)-2-pyridinyl]ethanimine |
| SMILES | C/C(=N\c1c(C)cccc1C)c1cc(C(F)(F)F)cc(/C(C)=N/c2c(C)cccc2C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C26H26F3N3.2ClH.Fe/c1-15-9-7-10-16(2)24(15)30-19(5)22-13-21(26(27,28)29)14-23(32-22)20(6)31-25-17(3)11-8-12-18(25)4;;;/h7-14H,1-6H3;2*1H;/q;;;+2/p-2/b30-19+,31-20+;;; |
| InChIKey | OMRPMOZPWRRPDS-ICKNTIHPSA-L |
| XLogP | 8.99 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.26 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|