About Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate
Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate (PubChem CID 589276) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is ethyl 2-oxo-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate |
| PubChem CID | 589276 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | ethyl 2-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=CC2=CC=CC=C2NC1=O |
| InChI | InChI=1S/C12H11NO3/c1-2-16-12(15)9-7-8-5-3-4-6-10(8)13-11(9)14/h3-7H,2H2,1H3,(H,13,14) |
| InChIKey | POZIHPKRJFLANV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 335 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate?
The IUPAC name of Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate (CID 589276) is ethyl 2-oxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate?
The canonical SMILES for Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate is CCOC(=O)C1=CC2=CC=CC=C2NC1=O.
What is the InChIKey of Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate?
The InChIKey is POZIHPKRJFLANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c1-2-16-12(15)9-7-8-5-3-4-6-10(8)13-11(9)14/h3-7H,2H2,1H3,(H,13,14).
What are the key properties of Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate?
Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate has a molecular weight of 217.22 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 2-oxo-1,2-dihydroquinoline-3-carboxylate is sourced from PubChem (CID 589276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).