C27H24FN3O3 — CID 58928312
(2S)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol (PubChem CID 58928312) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is (2S)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol.
| Compound Name | (2S)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 58928312 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (2S)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)phenoxy]-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol |
| SMILES | O[C@H](COc1ccc(-c2noc3cc(F)ccc23)cc1)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C27H24FN3O3/c28-18-7-10-23-26(13-18)34-30-27(23)17-5-8-20(9-6-17)33-16-19(32)14-31-12-11-22-21-3-1-2-4-24(21)29-25(22)15-31/h1-10,13,19,29,32H,11-12,14-16H2/t19-/m0/s1 |
| InChIKey | FVBKTSXQZWJGOO-IBGZPJMESA-N |
| XLogP | 4.91 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|