C25H34N2O2 — CID 58928373
(6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-2-[(4-methoxyphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 58928373) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-2-[(4-methoxyphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-2-[(4-methoxyphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 58928373 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (6R,9aS)-6-(4-methoxy-2,3-dimethylphenyl)-2-[(4-methoxyphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | COc1ccc(CN2CCN3[C@@H](CCC[C@@H]3c3ccc(OC)c(C)c3C)C2)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-18-19(2)25(29-4)13-12-23(18)24-7-5-6-21-17-26(14-15-27(21)24)16-20-8-10-22(28-3)11-9-20/h8-13,21,24H,5-7,14-17H2,1-4H3/t21-,24+/m0/s1 |
| InChIKey | VEZPXKVDRNRSSC-XUZZJYLKSA-N |
| XLogP | 4.73 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |