C29H36F3N3O3S — CID 58928568
methyl 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 58928568) has the molecular formula C29H36F3N3O3S and a molecular weight of 563.69 g/mol. Its IUPAC name is methyl 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 58928568 |
| Molecular Formula | C29H36F3N3O3S |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | methyl 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)C1CSC(C2(CCN3CC[C@@H]4Cc5[nH]c6ccc(C(F)(F)F)cc6c5[C@H](C)[C@H]4C3)CCOCC2)=N1 |
| InChI | InChI=1S/C29H36F3N3O3S/c1-17-21-15-35(10-6-28(7-11-38-12-8-28)27-34-24(16-39-27)26(36)37-2)9-5-18(21)13-23-25(17)20-14-19(29(30,31)32)3-4-22(20)33-23/h3-4,14,17-18,21,24,33H,5-13,15-16H2,1-2H3/t17-,18-,21-,24?/m1/s1 |
| InChIKey | PHVYVPHDCVDWDO-GOGFOOHQSA-N |
| XLogP | 5.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|