C27H36F3N3OS — CID 58928569
2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-1,3-thiazolidine (PubChem CID 58928569) has the molecular formula C27H36F3N3OS and a molecular weight of 507.67 g/mol. Its IUPAC name is 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-1,3-thiazolidine.
| Compound Name | 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 58928569 |
| Molecular Formula | C27H36F3N3OS |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 2-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-1,3-thiazolidine |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCC3(C4NCCS4)CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C27H36F3N3OS/c1-17-21-16-33(10-5-26(6-11-34-12-7-26)25-31-8-13-35-25)9-4-18(21)14-23-24(17)20-15-19(27(28,29)30)2-3-22(20)32-23/h2-3,15,17-18,21,25,31-32H,4-14,16H2,1H3/t17-,18-,21-,25?/m1/s1 |
| InChIKey | IJCSPCZXMWUIFI-NBKWEJFZSA-N |
| XLogP | 5.63 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|