C30H41F3N2O2 — CID 58928571
(E)-1-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4-methylpent-1-en-3-ol (PubChem CID 58928571) has the molecular formula C30H41F3N2O2 and a molecular weight of 518.66 g/mol. Its IUPAC name is (E)-1-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4-methylpent-1-en-3-ol.
| Compound Name | (E)-1-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 58928571 |
| Molecular Formula | C30H41F3N2O2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | (E)-1-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-4-methylpent-1-en-3-ol |
| SMILES | CC(C)C(O)/C=C/C1(CCN2CC[C@@H]3Cc4[nH]c5ccc(C(F)(F)F)cc5c4[C@H](C)[C@H]3C2)CCOCC1 |
| InChI | InChI=1S/C30H41F3N2O2/c1-19(2)27(36)6-8-29(10-14-37-15-11-29)9-13-35-12-7-21-16-26-28(20(3)24(21)18-35)23-17-22(30(31,32)33)4-5-25(23)34-26/h4-6,8,17,19-21,24,27,34,36H,7,9-16,18H2,1-3H3/b8-6+/t20-,21-,24-,27?/m1/s1 |
| InChIKey | BLPJFQQRZXVERW-PDFZLYATSA-N |
| XLogP | 6.54 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|