C24H31F3N2O2 — CID 58928574
4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-ol (PubChem CID 58928574) has the molecular formula C24H31F3N2O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-ol.
| Compound Name | 4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-ol |
|---|---|
| PubChem CID | 58928574 |
| Molecular Formula | C24H31F3N2O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-ol |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCC3(O)CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C24H31F3N2O2/c1-15-19-14-29(9-5-23(30)6-10-31-11-7-23)8-4-16(19)12-21-22(15)18-13-17(24(25,26)27)2-3-20(18)28-21/h2-3,13,15-16,19,28,30H,4-12,14H2,1H3/t15-,16-,19-/m1/s1 |
| InChIKey | UVRQHDLBLSGSID-GPMSIDNRSA-N |
| XLogP | 4.72 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|