C29H37F3N2O3 — CID 58928645
ethyl (E)-3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]prop-2-enoate (PubChem CID 58928645) has the molecular formula C29H37F3N2O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is ethyl (E)-3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58928645 |
| Molecular Formula | C29H37F3N2O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | ethyl (E)-3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1(CCN2CC[C@@H]3Cc4[nH]c5ccc(C(F)(F)F)cc5c4[C@H](C)[C@H]3C2)CCOCC1 |
| InChI | InChI=1S/C29H37F3N2O3/c1-3-37-26(35)6-8-28(10-14-36-15-11-28)9-13-34-12-7-20-16-25-27(19(2)23(20)18-34)22-17-21(29(30,31)32)4-5-24(22)33-25/h4-6,8,17,19-20,23,33H,3,7,9-16,18H2,1-2H3/b8-6+/t19-,20-,23-/m1/s1 |
| InChIKey | KIGQKBAPAZBMNP-JQCKXRDISA-N |
| XLogP | 6.09 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|