C32H20F4N2O6S — CID 58928711
[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate (PubChem CID 58928711) has the molecular formula C32H20F4N2O6S and a molecular weight of 636.58 g/mol. Its IUPAC name is [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate.
| Compound Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58928711 |
| Molecular Formula | C32H20F4N2O6S |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2c(c(OC(c3ccccc3)c3ccccc3)c3ncccc3c2OS(=O)(=O)C(F)(F)F)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C32H20F4N2O6S/c33-22-15-13-19(14-16-22)18-38-30(39)24-25(31(38)40)29(43-27(20-8-3-1-4-9-20)21-10-5-2-6-11-21)26-23(12-7-17-37-26)28(24)44-45(41,42)32(34,35)36/h1-17,27H,18H2 |
| InChIKey | KVXMHCJIQLOOCR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|