C8H12F2N2S — CID 58929558
[(1R,2S,4R)-5,5-difluoro-2-bicyclo[2.2.1]heptanyl]thiourea (PubChem CID 58929558) has the molecular formula C8H12F2N2S and a molecular weight of 206.26 g/mol. Its IUPAC name is [(1R,2S,4R)-5,5-difluoro-2-bicyclo[2.2.1]heptanyl]thiourea.
| Compound Name | [(1R,2S,4R)-5,5-difluoro-2-bicyclo[2.2.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 58929558 |
| Molecular Formula | C8H12F2N2S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | [(1R,2S,4R)-5,5-difluoro-2-bicyclo[2.2.1]heptanyl]thiourea |
| SMILES | NC(=S)N[C@H]1C[C@H]2C[C@@H]1CC2(F)F |
| InChI | InChI=1S/C8H12F2N2S/c9-8(10)3-4-1-5(8)2-6(4)12-7(11)13/h4-6H,1-3H2,(H3,11,12,13)/t4-,5-,6+/m1/s1 |
| InChIKey | ONYSTHNRYCBCAV-PBXRRBTRSA-N |
| XLogP | 1.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|