About 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene
3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene (PubChem CID 589299) has the molecular formula C7H12S2
and a molecular weight of 160.31 g/mol. Its IUPAC name is 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene.
Molecular Properties
| Compound Name | 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene |
| PubChem CID | 589299 |
| Molecular Formula | C7H12S2 |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene |
| SMILES | C=C(C)C=C(SC)SC |
| InChI | InChI=1S/C7H12S2/c1-6(2)5-7(8-3)9-4/h5H,1H2,2-4H3 |
| InChIKey | TYQMFKAGKCGQKJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene?
The IUPAC name of 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene (CID 589299) is 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene.
What is the SMILES notation for 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene?
The canonical SMILES for 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene is C=C(C)C=C(SC)SC.
What is the InChIKey of 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene?
The InChIKey is TYQMFKAGKCGQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S2/c1-6(2)5-7(8-3)9-4/h5H,1H2,2-4H3.
What are the key properties of 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene?
3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene has a molecular weight of 160.31 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-bis(methylsulfanyl)buta-1,3-diene is sourced from PubChem (CID 589299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).