C32H33N3O7 — CID 58930440
N-(2-aminophenyl)-4-[[4,5-dimethoxy-2-(3,4,5-trimethoxybenzoyl)anilino]methyl]benzamide (PubChem CID 58930440) has the molecular formula C32H33N3O7 and a molecular weight of 571.63 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4,5-dimethoxy-2-(3,4,5-trimethoxybenzoyl)anilino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4,5-dimethoxy-2-(3,4,5-trimethoxybenzoyl)anilino]methyl]benzamide |
|---|---|
| PubChem CID | 58930440 |
| Molecular Formula | C32H33N3O7 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4,5-dimethoxy-2-(3,4,5-trimethoxybenzoyl)anilino]methyl]benzamide |
| SMILES | COc1cc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)c(C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C32H33N3O7/c1-38-26-16-22(30(36)21-14-28(40-3)31(42-5)29(15-21)41-4)25(17-27(26)39-2)34-18-19-10-12-20(13-11-19)32(37)35-24-9-7-6-8-23(24)33/h6-17,34H,18,33H2,1-5H3,(H,35,37) |
| InChIKey | JNLRQHICSVTTCY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|