About 4-hydroxy-3-phenyl-1,2,4-triazole
4-hydroxy-3-phenyl-1,2,4-triazole (PubChem CID 589306) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-hydroxy-3-phenyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 4-hydroxy-3-phenyl-1,2,4-triazole |
| PubChem CID | 589306 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 4-hydroxy-3-phenyl-1,2,4-triazole |
| SMILES | On1cnnc1-c1ccccc1 |
| InChI | InChI=1S/C8H7N3O/c12-11-6-9-10-8(11)7-4-2-1-3-5-7/h1-6,12H |
| InChIKey | ZKZDIHSYTZBNGV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-phenyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-phenyl-1,2,4-triazole?
The IUPAC name of 4-hydroxy-3-phenyl-1,2,4-triazole (CID 589306) is 4-hydroxy-3-phenyl-1,2,4-triazole.
What is the SMILES notation for 4-hydroxy-3-phenyl-1,2,4-triazole?
The canonical SMILES for 4-hydroxy-3-phenyl-1,2,4-triazole is On1cnnc1-c1ccccc1.
What is the InChIKey of 4-hydroxy-3-phenyl-1,2,4-triazole?
The InChIKey is ZKZDIHSYTZBNGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c12-11-6-9-10-8(11)7-4-2-1-3-5-7/h1-6,12H.
What are the key properties of 4-hydroxy-3-phenyl-1,2,4-triazole?
4-hydroxy-3-phenyl-1,2,4-triazole has a molecular weight of 161.16 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-phenyl-1,2,4-triazole is sourced from PubChem (CID 589306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).