About 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione
1,7-dihydropyrrolo[2,3-b]pyridine-4-thione (PubChem CID 58930955) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione.
Molecular Properties
| Compound Name | 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione |
| PubChem CID | 58930955 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione |
| SMILES | S=c1cc[nH]c2[nH]ccc12 |
| InChI | InChI=1S/C7H6N2S/c10-6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H2,8,9,10) |
| InChIKey | GLDRFUJFSNNWIM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione?
The IUPAC name of 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione (CID 58930955) is 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione.
What is the SMILES notation for 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione?
The canonical SMILES for 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione is S=c1cc[nH]c2[nH]ccc12.
What is the InChIKey of 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione?
The InChIKey is GLDRFUJFSNNWIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c10-6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H2,8,9,10).
What are the key properties of 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione?
1,7-dihydropyrrolo[2,3-b]pyridine-4-thione has a molecular weight of 150.21 g/mol, XLogP of 2.23, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydropyrrolo[2,3-b]pyridine-4-thione is sourced from PubChem (CID 58930955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).