C20H19NO5 — CID 589314
2-phenyl-5-(2-phenyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-6-ol (PubChem CID 589314) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-phenyl-5-(2-phenyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-6-ol.
| Compound Name | 2-phenyl-5-(2-phenyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-6-ol |
|---|---|
| PubChem CID | 589314 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-phenyl-5-(2-phenyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-6-ol |
| SMILES | OC1C2N=C(c3ccccc3)OC2OC1C1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C20H19NO5/c22-16-15-20(26-18(21-15)12-7-3-1-4-8-12)25-17(16)14-11-23-19(24-14)13-9-5-2-6-10-13/h1-10,14-17,19-20,22H,11H2 |
| InChIKey | ZWGVXMPIRITKJB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |