C38H55NO8 — CID 58932208
[(4E)-2-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] (4-nitrophenyl) carbonate (PubChem CID 58932208) has the molecular formula C38H55NO8 and a molecular weight of 653.86 g/mol. Its IUPAC name is [(4E)-2-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(4E)-2-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 58932208 |
| Molecular Formula | C38H55NO8 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | [(4E)-2-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] (4-nitrophenyl) carbonate |
| SMILES | CCC(C)C(C)C1OC1CC(C)(C)/C=C/C=C(\C)C1OC(=O)CC(C)CCC(C)C(OC(=O)Oc2ccc([N+](=O)[O-])cc2)/C=C/C1C |
| InChI | InChI=1S/C38H55NO8/c1-10-25(3)29(7)36-33(45-36)23-38(8,9)21-11-12-27(5)35-28(6)15-20-32(26(4)14-13-24(2)22-34(40)47-35)46-37(41)44-31-18-16-30(17-19-31)39(42)43/h11-12,15-21,24-26,28-29,32-33,35-36H,10,13-14,22-23H2,1-9H3/b20-15+,21-11+,27-12+ |
| InChIKey | HCUIGGMABLRLSE-SVQXUIFQSA-N |
| XLogP | 9.41 |
| TPSA | 117.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|