C33H47N7O — CID 58932501
2-[3-[2-[[(cyanoamino)-(4-methylpiperazin-1-yl)methyl]amino]ethyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]-N,N-diethyl-2-methylpropanamide (PubChem CID 58932501) has the molecular formula C33H47N7O and a molecular weight of 557.79 g/mol. Its IUPAC name is 2-[3-[2-[[(cyanoamino)-(4-methylpiperazin-1-yl)methyl]amino]ethyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]-N,N-diethyl-2-methylpropanamide.
| Compound Name | 2-[3-[2-[[(cyanoamino)-(4-methylpiperazin-1-yl)methyl]amino]ethyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]-N,N-diethyl-2-methylpropanamide |
|---|---|
| PubChem CID | 58932501 |
| Molecular Formula | C33H47N7O |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 557.38 |
| IUPAC Name | 2-[3-[2-[[(cyanoamino)-(4-methylpiperazin-1-yl)methyl]amino]ethyl]-2-(3,5-dimethylphenyl)-1H-indol-5-yl]-N,N-diethyl-2-methylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)(C)c1ccc2[nH]c(-c3cc(C)cc(C)c3)c(CCNC(NC#N)N3CCN(C)CC3)c2c1 |
| InChI | InChI=1S/C33H47N7O/c1-8-39(9-2)31(41)33(5,6)26-10-11-29-28(21-26)27(30(37-29)25-19-23(3)18-24(4)20-25)12-13-35-32(36-22-34)40-16-14-38(7)15-17-40/h10-11,18-21,32,35-37H,8-9,12-17H2,1-7H3 |
| InChIKey | RHWGGYHXDJDTBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|