About 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one
1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 58932582) has the molecular formula C14H17BrN2O3
and a molecular weight of 341.21 g/mol. Its IUPAC name is 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 58932582 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | NCCCN1C(=O)C2(OCCCO2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H17BrN2O3/c15-10-3-4-12-11(9-10)14(19-7-2-8-20-14)13(18)17(12)6-1-5-16/h3-4,9H,1-2,5-8,16H2 |
| InChIKey | GWOSGBVMRDAGAJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one (CID 58932582) is 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one is NCCCN1C(=O)C2(OCCCO2)c2cc(Br)ccc21.
What is the InChIKey of 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is GWOSGBVMRDAGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O3/c15-10-3-4-12-11(9-10)14(19-7-2-8-20-14)13(18)17(12)6-1-5-16/h3-4,9H,1-2,5-8,16H2.
What are the key properties of 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one?
1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 341.21 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(3-aminopropyl)-5'-bromospiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 58932582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).