C20H34BO9S — CID 58932841
CID 58932841 (PubChem CID 58932841) has the molecular formula C20H34BO9S and a molecular weight of 463.37 g/mol.
| Compound Name | CID 58932841 |
|---|---|
| PubChem CID | 58932841 |
| Molecular Formula | C20H34BO9S |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | — |
| SMILES | [3H][B]SOCC(C)(C)[C@]1(OC)OC(C[C@@H](O)[C@@H](C)O)C/C(=C\C(=O)OC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C20H34BO9S/c1-7-16(24)29-18-13(9-17(25)26-5)8-14(10-15(23)12(2)22)30-20(18,27-6)19(3,4)11-28-31-21/h9,12,14-15,18,21-23H,7-8,10-11H2,1-6H3/b13-9+/t12-,14?,15-,18+,20-/m1/s1/i21T |
| InChIKey | FAWDCYNKNWZIGR-WTLZEASSSA-N |
| XLogP | 1.18 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|