C26H42O9 — CID 58932861
[(2S,3S,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate (PubChem CID 58932861) has the molecular formula C26H42O9 and a molecular weight of 498.61 g/mol. Its IUPAC name is [(2S,3S,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 58932861 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(2S,3S,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1C(=CC(=O)OC)C[C@@H](C[C@@H](O)CO)O[C@@]1(OC)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C26H42O9/c1-6-7-8-9-10-12-22(30)34-24-19(16-23(31)32-4)15-21(17-20(29)18-28)35-26(24,33-5)25(2,3)13-11-14-27/h11,13-14,16,20-21,24,28-29H,6-10,12,15,17-18H2,1-5H3/b13-11+,19-16?/t20-,21+,24+,26-/m1/s1 |
| InChIKey | RFWSXFUQSYHAGE-BKSHTJCFSA-N |
| XLogP | 3.01 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|