C25H40O9 — CID 58932884
[(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate (PubChem CID 58932884) has the molecular formula C25H40O9 and a molecular weight of 484.59 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 58932884 |
| Molecular Formula | C25H40O9 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[(2R)-2,3-dihydroxypropyl]-2-hydroxy-4-(2-methoxy-2-oxoethylidene)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](C[C@@H](O)CO)O[C@@]1(O)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C25H40O9/c1-5-6-7-8-9-11-21(29)33-23-18(15-22(30)32-4)14-20(16-19(28)17-27)34-25(23,31)24(2,3)12-10-13-26/h10,12-13,15,19-20,23,27-28,31H,5-9,11,14,16-17H2,1-4H3/b12-10+,18-15+/t19-,20+,23+,25-/m1/s1 |
| InChIKey | CUWRJOZYQQLIDX-MMEUZJFTSA-N |
| XLogP | 2.36 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|