About 4-amino-6-ethyl-2,3-dimethylphenol
4-amino-6-ethyl-2,3-dimethylphenol (PubChem CID 58932968) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-amino-6-ethyl-2,3-dimethylphenol.
Molecular Properties
| Compound Name | 4-amino-6-ethyl-2,3-dimethylphenol |
| PubChem CID | 58932968 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-amino-6-ethyl-2,3-dimethylphenol |
| SMILES | CCc1cc(N)c(C)c(C)c1O |
| InChI | InChI=1S/C10H15NO/c1-4-8-5-9(11)6(2)7(3)10(8)12/h5,12H,4,11H2,1-3H3 |
| InChIKey | NRMIZDPXEKYBSN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-ethyl-2,3-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-ethyl-2,3-dimethylphenol?
The IUPAC name of 4-amino-6-ethyl-2,3-dimethylphenol (CID 58932968) is 4-amino-6-ethyl-2,3-dimethylphenol.
What is the SMILES notation for 4-amino-6-ethyl-2,3-dimethylphenol?
The canonical SMILES for 4-amino-6-ethyl-2,3-dimethylphenol is CCc1cc(N)c(C)c(C)c1O.
What is the InChIKey of 4-amino-6-ethyl-2,3-dimethylphenol?
The InChIKey is NRMIZDPXEKYBSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-4-8-5-9(11)6(2)7(3)10(8)12/h5,12H,4,11H2,1-3H3.
What are the key properties of 4-amino-6-ethyl-2,3-dimethylphenol?
4-amino-6-ethyl-2,3-dimethylphenol has a molecular weight of 165.24 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-ethyl-2,3-dimethylphenol is sourced from PubChem (CID 58932968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).